Products 76704-91-1
CAS 76704-91-1 is the registry number for cis-1-Methyl-1,2-cyclohexanedicarboxylic Acid. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
(1R)-1-methylcyclohexane-1,2-dicarboxylic acid (CAS 76704-91-1) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: (1R)-1-methylcyclohexane-1,2-dicarboxylic acid. InChIKey: PMUPSYZVABJEKC-IOJJLOCKSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | (1R)-1-methylcyclohexane-1,2-dicarboxylic acid |
| InChIKey | PMUPSYZVABJEKC-IOJJLOCKSA-N |
| SMILES | C[C@]1(CCCCC1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)