Products 76708-72-0

CAS 76708-72-0 is the registry number for 2,5,2'-Trimethylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1,4-dimethyl-2-(2-methylphenyl)benzene (CAS 76708-72-0) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1,4-dimethyl-2-(2-methylphenyl)benzene. InChIKey: JNSXQCXLNYLQQS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16
Molecular weight196.29 g/mol
IUPAC name1,4-dimethyl-2-(2-methylphenyl)benzene
InChIKeyJNSXQCXLNYLQQS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)C2=CC=CC=C2C

Computed by PubChem (NCBI)