Products 767254-15-9

CAS 767254-15-9 is the registry number for 2-Methyl-4,5,6,7-tetrahydro-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid (CAS 767254-15-9) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid. InChIKey: UTSSXYRZEMUIAT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O2
Molecular weight180.20 g/mol
IUPAC name2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid
InChIKeyUTSSXYRZEMUIAT-UHFFFAOYSA-N
SMILESCC1=NC2=C(N1)CC(CC2)C(=O)O

Computed by PubChem (NCBI)