CAS 767254-15-9 is the registry number for 2-Methyl-4,5,6,7-tetrahydro-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid (CAS 767254-15-9) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid. InChIKey: UTSSXYRZEMUIAT-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid |
| InChIKey | UTSSXYRZEMUIAT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)CC(CC2)C(=O)O |
Computed by PubChem (NCBI)