Products 76844-70-7
CAS 76844-70-7 appears in our catalog under these names: 6-Hydroxywogonin, 6-Hydroxywogonin, 99.95%, 6-HYDROXYWOGONIN, ≥95%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 1 mg, 5 mg, 5mg.
5,6,7-trihydroxy-8-methoxy-2-phenylchromen-4-one (CAS 76844-70-7) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 5,6,7-trihydroxy-8-methoxy-2-phenylchromen-4-one. InChIKey: FVANZQZQOXHAPG-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 5,6,7-trihydroxy-8-methoxy-2-phenylchromen-4-one |
| InChIKey | FVANZQZQOXHAPG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C(=C1O)O)O)C(=O)C=C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)