Products 76937-77-4
CAS 76937-77-4 appears in our catalog under these names: Indoleacetic Acid-d4, >95% (HPLC), 3-Indoleacetic acid-d4, 99.40%. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
2-(4,5,6,7-tetradeuterio-1H-indol-3-yl)acetic acid (CAS 76937-77-4) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 179.21 g/mol. IUPAC name: 2-(4,5,6,7-tetradeuterio-1H-indol-3-yl)acetic acid. InChIKey: SEOVTRFCIGRIMH-RHQRLBAQSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 179.21 g/mol |
| IUPAC name | 2-(4,5,6,7-tetradeuterio-1H-indol-3-yl)acetic acid |
| InChIKey | SEOVTRFCIGRIMH-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=CN2)CC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)