CAS 76937-78-5 appears in our catalog under these names: 3–Indoleacetic acid–D5, Indole-2,4,5,6,7-d5-3-acetic Acid, >95% (HPLC), Indole-2,4,5,6,7-d5-3-acetic Acid, 98 atom % D, min 98% Chemical Purity, Indole-2,4,5,6,7-d5-3-acetic acid, 3-Indoleacetic acid-d5, 99.76%. Offered by: GLPBio, TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 0,05g, 0,1g, 0,5mg, 1 mg, 10mM/1mL.
2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid (CAS 76937-78-5) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 180.21 g/mol. IUPAC name: 2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid. InChIKey: SEOVTRFCIGRIMH-SNOLXCFTSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 180.21 g/mol |
| IUPAC name | 2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid |
| InChIKey | SEOVTRFCIGRIMH-SNOLXCFTSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)