CAS 7697-32-7 appears in our catalog under these names: 4-bromo-3,5-dimethylbenzoic acid, 98%, 4–Bromo–3,5–dimethylbenzoic acid, 4-Bromo-3,5-dimethylbenzoic acid, 4-Bromo-3,5-dimethylbenzoic acid 98%, 3,5-Dimethyl-4-bromobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 50g, 250mg.
4-bromo-3,5-dimethylbenzoic acid (CAS 7697-32-7) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 4-bromo-3,5-dimethylbenzoic acid. InChIKey: OKEOADKQDIJJMU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 4-bromo-3,5-dimethylbenzoic acid |
| InChIKey | OKEOADKQDIJJMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(=O)O |
Computed by PubChem (NCBI)