CAS 770703-11-2 appears in our catalog under these names: Ertapenem Impurity 15, 3-((((2S,4R)-4-Hydroxy-2-pyrrolidinyl)carbonyl)amino)benzoic Acid, 3-{((4R)-4-Hydroxy-L-prolyl)amino}benzoic acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 500mg, 250mg.
3-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]benzoic acid (CAS 770703-11-2) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 3-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]benzoic acid. InChIKey: IQPYLVCJTJLSDO-ZJUUUORDSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]benzoic acid |
| InChIKey | IQPYLVCJTJLSDO-ZJUUUORDSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)NC2=CC=CC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)