CAS 771460-12-9 appears in our catalog under these names: 6,7-Dimethoxyquinolin-2-amine, 95%, 6,7-Dimethoxyquinolin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6,7-dimethoxyquinolin-2-amine (CAS 771460-12-9) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 6,7-dimethoxyquinolin-2-amine. InChIKey: CEHIZHJVEUNKPQ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 6,7-dimethoxyquinolin-2-amine |
| InChIKey | CEHIZHJVEUNKPQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CC(=N2)N)OC |
Computed by PubChem (NCBI)