CAS 773102-27-5 appears in our catalog under these names: 2-(2,4,6-Trifluorophenyl)-1,3-dioxolane, 97%, 2-(2,4,6-Trifluorophenyl)-1,3-dioxolane, 98%, 2-(2,4,6-Trifluorophenyl)-1,3-dioxolane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
2-(2,4,6-trifluorophenyl)-1,3-dioxolane (CAS 773102-27-5) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2-(2,4,6-trifluorophenyl)-1,3-dioxolane. InChIKey: YICCBVXVPOEKCW-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2-(2,4,6-trifluorophenyl)-1,3-dioxolane |
| InChIKey | YICCBVXVPOEKCW-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2F)F)F |
Computed by PubChem (NCBI)