CAS 773102-51-5 is the registry number for 2-(2,3,5-Trifluorophenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,3,5-trifluorophenyl)-1,3-dioxolane (CAS 773102-51-5) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2-(2,3,5-trifluorophenyl)-1,3-dioxolane. InChIKey: ICYTYXAYPOWBAD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2-(2,3,5-trifluorophenyl)-1,3-dioxolane |
| InChIKey | ICYTYXAYPOWBAD-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC(=C2)F)F)F |
Computed by PubChem (NCBI)