Products 77326-46-6
CAS 77326-46-6 appears in our catalog under these names: Methyl 2–Cyano–3–Nitrobenzoate, Methyl 2-cyano-3-nitrobenzoate 97%, Methyl 2-cyano-3-nitrobenzoate, 97%, 97%, Methyl 2-cyano-3-nitrobenzoate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.
Methyl 2-cyano-3-nitrobenzoate (CAS 77326-46-6) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: methyl 2-cyano-3-nitrobenzoate. InChIKey: IKKNSRWBYKCBBC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | methyl 2-cyano-3-nitrobenzoate |
| InChIKey | IKKNSRWBYKCBBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)