CAS 773871-83-3 is the registry number for 2-(3,4-Dichlorophenyl)propane-1,3-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)propane-1,3-diol (CAS 773871-83-3) is a chemical compound with the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)propane-1,3-diol. InChIKey: UFIWJDMOIDVROW-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)propane-1,3-diol |
| InChIKey | UFIWJDMOIDVROW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CO)CO)Cl)Cl |
Computed by PubChem (NCBI)