CAS 773872-39-2 appears in our catalog under these names: (4'-Chloro-[1,1'-biphenyl]-3-yl)methanol, 95%, (4'-Chloro-(1,1'-biphenyl)-3-yl)methanol, 95+%, (3-(4-Chlorophenyl)phenyl)methanol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
[3-(4-chlorophenyl)phenyl]methanol (CAS 773872-39-2) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: [3-(4-chlorophenyl)phenyl]methanol. InChIKey: WBRGFIOYXJHTHH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | [3-(4-chlorophenyl)phenyl]methanol |
| InChIKey | WBRGFIOYXJHTHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)Cl)CO |
Computed by PubChem (NCBI)