CAS 773876-05-4 appears in our catalog under these names: Methyl 2,3-difluoro-6-methoxybenzoate, 95%, 2,3-Difluoro-6-methoxybenzoic acid methyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
Methyl 2,3-difluoro-6-methoxybenzoate (CAS 773876-05-4) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: methyl 2,3-difluoro-6-methoxybenzoate. InChIKey: KQSNVGDMYHDQRO-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | methyl 2,3-difluoro-6-methoxybenzoate |
| InChIKey | KQSNVGDMYHDQRO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)C(=O)OC |
Computed by PubChem (NCBI)