Products 77443-35-7
CAS 77443-35-7 is the registry number for 1,1-Dimethylethyl N-[(3S)-tetrahydro-5,5-dimethyl-2-oxo-3-furanyl]carbamate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate (CAS 77443-35-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate. InChIKey: PUJPOKNGBSGXOI-ZETCQYMHSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl N-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]carbamate |
| InChIKey | PUJPOKNGBSGXOI-ZETCQYMHSA-N |
| SMILES | CC1(C[C@@H](C(=O)O1)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)