CAS 774495-96-4 is the registry number for Rel-(2R,5S)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 774495-96-4) is a chemical compound with the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. IUPAC name: (2R,5S)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: FKENQMMABCRJMK-NTSWFWBYSA-N.
| Molecular formula | C8H11NO5S |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | (2R,5S)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | FKENQMMABCRJMK-NTSWFWBYSA-N |
| SMILES | CC1([C@H](N2[C@@H](S1(=O)=O)CC2=O)C(=O)O)C |
Computed by PubChem (NCBI)