Products 1146294-71-4

CAS 1146294-71-4 is the registry number for 4-(Dimethylsulfamoyl)-5-methylfuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(dimethylsulfamoyl)-5-methylfuran-2-carboxylic acid (CAS 1146294-71-4) is a chemical compound with the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. IUPAC name: 4-(dimethylsulfamoyl)-5-methylfuran-2-carboxylic acid. InChIKey: YDYSZRWIHKNHPB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO5S
Molecular weight233.24 g/mol
IUPAC name4-(dimethylsulfamoyl)-5-methylfuran-2-carboxylic acid
InChIKeyYDYSZRWIHKNHPB-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)C(=O)O)S(=O)(=O)N(C)C

Computed by PubChem (NCBI)