Products 306936-39-0

CAS 306936-39-0 appears in our catalog under these names: 5-[(Dimethylamino)sulfonyl]-2-methyl-3-furoic acid, 95%, 5-((Dimethylamino)sulfonyl)-2-methyl-3-furoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.

Structural formula: {0} (CAS {1})

5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid (CAS 306936-39-0) is a chemical compound with the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. IUPAC name: 5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid. InChIKey: DUFCMRCMPHIFTR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO5S
Molecular weight233.24 g/mol
IUPAC name5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid
InChIKeyDUFCMRCMPHIFTR-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)S(=O)(=O)N(C)C)C(=O)O

Computed by PubChem (NCBI)