CAS 2112512-12-4 is the registry number for Ethyl 2-((methylsulfonyl)methyl)oxazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(methylsulfonylmethyl)-1,3-oxazole-5-carboxylate (CAS 2112512-12-4) is a chemical compound with the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. IUPAC name: ethyl 2-(methylsulfonylmethyl)-1,3-oxazole-5-carboxylate. InChIKey: NZZZGUZCSSDMQP-UHFFFAOYSA-N.
| Molecular formula | C8H11NO5S |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | ethyl 2-(methylsulfonylmethyl)-1,3-oxazole-5-carboxylate |
| InChIKey | NZZZGUZCSSDMQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(O1)CS(=O)(=O)C |
Computed by PubChem (NCBI)