Products 1697292-46-8

CAS 1697292-46-8 is the registry number for 4-(3,5-Dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(3,5-dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid (CAS 1697292-46-8) is a chemical compound with the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. IUPAC name: 4-(3,5-dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid. InChIKey: CLLUPOYGXQQRCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO5S
Molecular weight233.24 g/mol
IUPAC name4-(3,5-dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid
InChIKeyCLLUPOYGXQQRCQ-UHFFFAOYSA-N
SMILESC1C(=O)N(C(=O)CS1)CCC(C(=O)O)O

Computed by PubChem (NCBI)