CAS 1697292-46-8 is the registry number for 4-(3,5-Dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,5-dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid (CAS 1697292-46-8) is a chemical compound with the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. IUPAC name: 4-(3,5-dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid. InChIKey: CLLUPOYGXQQRCQ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO5S |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 4-(3,5-dioxothiomorpholin-4-yl)-2-hydroxybutanoic acid |
| InChIKey | CLLUPOYGXQQRCQ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)CS1)CCC(C(=O)O)O |
Computed by PubChem (NCBI)