Products 7745-92-8
CAS 7745-92-8 appears in our catalog under these names: 2–Iodo–4–nitrotoluene, 2-Iodo-4-nitrotoluene, 97% , 2-Iodo-4-nitrotoluene, 2-Iodo-4-nitrotoluene, >97.0%(GC), 2-Iodo-1-methyl-4-nitrobenzene 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 10g, 25g, 500g, 5g, 0,05kg, 0,25kg, 0,5kg.
2-iodo-1-methyl-4-nitrobenzene (CAS 7745-92-8) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 2-iodo-1-methyl-4-nitrobenzene. InChIKey: BUQSRXQJUZTIEW-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 2-iodo-1-methyl-4-nitrobenzene |
| InChIKey | BUQSRXQJUZTIEW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)