CAS 77611-71-3 is the registry number for 1,2-Bis(3,5-dimethylphenyl)diazene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Bis(3,5-dimethylphenyl)diazene (CAS 77611-71-3) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: bis(3,5-dimethylphenyl)diazene. InChIKey: KQJYKIFOKLVEKF-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | bis(3,5-dimethylphenyl)diazene |
| InChIKey | KQJYKIFOKLVEKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N=NC2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)