CAS 776247-30-4 appears in our catalog under these names: 3-(Butane-1-sulfonyl)aniline, 95%, 3-(Butane-1-sulfonyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-butylsulfonylaniline (CAS 776247-30-4) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: 3-butylsulfonylaniline. InChIKey: AAQPOJXXWZKHNL-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | 3-butylsulfonylaniline |
| InChIKey | AAQPOJXXWZKHNL-UHFFFAOYSA-N |
| SMILES | CCCCS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)