CAS 77629-53-9 appears in our catalog under these names: Ethyl 5,6-dimethylnicotinate, 95%, Ethyl 5,6-Dimethylnicotinate, >95% (GC). Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 500mg.
Ethyl 5,6-dimethylpyridine-3-carboxylate (CAS 77629-53-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl 5,6-dimethylpyridine-3-carboxylate. InChIKey: QDWQAVBUPASDFW-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl 5,6-dimethylpyridine-3-carboxylate |
| InChIKey | QDWQAVBUPASDFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C(=C1)C)C |
Computed by PubChem (NCBI)