Products 777031-99-9

CAS 777031-99-9 is the registry number for 4-(3-Ethoxyphenoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(3-ethoxyphenoxy)benzoic acid (CAS 777031-99-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 4-(3-ethoxyphenoxy)benzoic acid. InChIKey: IKYUBEOMRGCAGB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O4
Molecular weight258.27 g/mol
IUPAC name4-(3-ethoxyphenoxy)benzoic acid
InChIKeyIKYUBEOMRGCAGB-UHFFFAOYSA-N
SMILESCCOC1=CC(=CC=C1)OC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)