CAS 77831-51-7 is the registry number for 2-(2,6-Dichlorophenyl)-N-hydroxyacetimidamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichlorophenyl)-N'-hydroxyethanimidamide (CAS 77831-51-7) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-N'-hydroxyethanimidamide. InChIKey: FPLPJXAQHSVAMM-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | FPLPJXAQHSVAMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)