CAS 778602-46-3 appears in our catalog under these names: 2-(((Benzyloxy)carbonyl)amino)isonicotinic acid, 98%, 2-(((Benzyloxy)carbonyl)amino)isonicotinic acid, 97%, 97%, 2-(((Benzyloxy)carbonyl)amino)isonicotinic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g, 10g.
2-(phenylmethoxycarbonylamino)pyridine-4-carboxylic acid (CAS 778602-46-3) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)pyridine-4-carboxylic acid. InChIKey: YUOGNATZUOHKSP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)pyridine-4-carboxylic acid |
| InChIKey | YUOGNATZUOHKSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)