Products 7795-71-3

CAS 7795-71-3 is the registry number for 4-Formyl-7-methoxy-1-benzofuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-formyl-7-methoxy-1-benzofuran-2-carboxylic acid (CAS 7795-71-3) is a chemical compound with the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. IUPAC name: 4-formyl-7-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: YDZWKNQEWKZVPD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O5
Molecular weight220.18 g/mol
IUPAC name4-formyl-7-methoxy-1-benzofuran-2-carboxylic acid
InChIKeyYDZWKNQEWKZVPD-UHFFFAOYSA-N
SMILESCOC1=C2C(=C(C=C1)C=O)C=C(O2)C(=O)O

Computed by PubChem (NCBI)