Products 78103-18-1
CAS 78103-18-1 is the registry number for Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)(Decitabine Impurity). Offered by: TRC. Available pack sizes: 10g.
[(4S,5R)-2-methoxy-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate (CAS 78103-18-1) is a chemical compound with the molecular formula C22H24O6 and a molecular weight of 384.4 g/mol. IUPAC name: [(4S,5R)-2-methoxy-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate. InChIKey: UKFSGKLSXCFJNM-ABZYKWASSA-N.
| Molecular formula | C22H24O6 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [(4S,5R)-2-methoxy-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate |
| InChIKey | UKFSGKLSXCFJNM-ABZYKWASSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2CC(OC[C@H]2OC(=O)C3=CC=C(C=C3)C)OC |
Computed by PubChem (NCBI)