CAS 78185-67-8 is the registry number for Decitabine Impurity 6 (beta-D-Erythro-Pentopyranoside-Methyl-2-Deoxy-bis(4-methylbenzoate)). Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4S,5R)-2-methoxy-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate (CAS 78185-67-8) is a chemical compound with the molecular formula C22H24O6 and a molecular weight of 384.4 g/mol. IUPAC name: [(2R,4S,5R)-2-methoxy-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate. InChIKey: UKFSGKLSXCFJNM-XUVXKRRUSA-N.
| Molecular formula | C22H24O6 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [(2R,4S,5R)-2-methoxy-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate |
| InChIKey | UKFSGKLSXCFJNM-XUVXKRRUSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2C[C@@H](OC[C@H]2OC(=O)C3=CC=C(C=C3)C)OC |
Computed by PubChem (NCBI)