Products 145701-12-8
CAS 145701-12-8 appears in our catalog under these names: Kadsurenin A, Kadsurenin A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg.
[(1R,5S,6R,7R,8R)-6-(1,3-benzodioxol-5-yl)-1-methoxy-7-methyl-4-oxo-3-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate (CAS 145701-12-8) is a chemical compound with the molecular formula C22H24O6 and a molecular weight of 384.4 g/mol. IUPAC name: [(1R,5S,6R,7R,8R)-6-(1,3-benzodioxol-5-yl)-1-methoxy-7-methyl-4-oxo-3-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate. InChIKey: LCYNORHWGQHDLP-MHTCVMEGSA-N.
| Molecular formula | C22H24O6 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [(1R,5S,6R,7R,8R)-6-(1,3-benzodioxol-5-yl)-1-methoxy-7-methyl-4-oxo-3-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate |
| InChIKey | LCYNORHWGQHDLP-MHTCVMEGSA-N |
| SMILES | C[C@@H]1[C@H]([C@H]2[C@H]([C@@]1(C=C(C2=O)CC=C)OC)OC(=O)C)C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)
Synonyms:
Kadsurenin A, orb1942772