Products 1423035-39-5
CAS 1423035-39-5 is the registry number for Methyl 2-deoxy-3,5-di-o-toluoyl-l-ribofuranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[(2S,3R)-5-methoxy-3-(2-methylbenzoyl)oxyoxolan-2-yl]methyl 2-methylbenzoate (CAS 1423035-39-5) is a chemical compound with the molecular formula C22H24O6 and a molecular weight of 384.4 g/mol. IUPAC name: [(2S,3R)-5-methoxy-3-(2-methylbenzoyl)oxyoxolan-2-yl]methyl 2-methylbenzoate. InChIKey: UFGIXHAOFWYWJX-LFPSWIHMSA-N.
| Molecular formula | C22H24O6 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [(2S,3R)-5-methoxy-3-(2-methylbenzoyl)oxyoxolan-2-yl]methyl 2-methylbenzoate |
| InChIKey | UFGIXHAOFWYWJX-LFPSWIHMSA-N |
| SMILES | CC1=CC=CC=C1C(=O)OC[C@H]2[C@@H](CC(O2)OC)OC(=O)C3=CC=CC=C3C |
Computed by PubChem (NCBI)