Products 22837-36-1
CAS 22837-36-1 is the registry number for Methyl 2-deoxy-3,5-di-O-toluoyl-L-ribofuranoside. Offered by: Biosynth. Available pack sizes: 5g, 2g.
[(2S,3R)-5-methoxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 22837-36-1) is a chemical compound with the molecular formula C22H24O6 and a molecular weight of 384.4 g/mol. IUPAC name: [(2S,3R)-5-methoxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: MTMWQYDEGWXCTH-LFPSWIHMSA-N.
| Molecular formula | C22H24O6 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [(2S,3R)-5-methoxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | MTMWQYDEGWXCTH-LFPSWIHMSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@H]2[C@@H](CC(O2)OC)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)