CAS 78210-43-2 appears in our catalog under these names: Dipyridin-3-ylmethane, 95+%, Dipyridin–3–ylmethane. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-(pyridin-3-ylmethyl)pyridine (CAS 78210-43-2) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 3-(pyridin-3-ylmethyl)pyridine. InChIKey: IFPGYRGTXVSLDQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 3-(pyridin-3-ylmethyl)pyridine |
| InChIKey | IFPGYRGTXVSLDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC2=CN=CC=C2 |
Computed by PubChem (NCBI)