CAS 78210-78-3 appears in our catalog under these names: 6-Methyl-2,3'-bipyridine, 95%, 6-Methyl-2,3'-bipyridine, >95% (HPLC), 6–Methyl–2,3'–bipyridine, 6-Methyl-2,3'-bipyridine 97%, 6-Methyl-2,3'-bipyridine, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 50mg.
2-methyl-6-pyridin-3-ylpyridine (CAS 78210-78-3) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-methyl-6-pyridin-3-ylpyridine. InChIKey: JGRRGVGXYDGQLG-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-methyl-6-pyridin-3-ylpyridine |
| InChIKey | JGRRGVGXYDGQLG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)