Products 784092-90-6
CAS 784092-90-6 appears in our catalog under these names: α-Amino-4-carboxybenzenebutanoic acid, 98%, H-DL-HoPhe(4-COOH)-OH, 95%, 4-(3-Amino-3-carboxypropyl)benzoic acid, 95%, 4-(3-Amino-3-carboxypropyl)benzoic acid, 98%, α-Amino-4-carboxybenzenebutanoic acid, 98%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-(3-amino-3-carboxypropyl)benzoic acid (CAS 784092-90-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 4-(3-amino-3-carboxypropyl)benzoic acid. InChIKey: SKYJBEYFTBBNEF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 4-(3-amino-3-carboxypropyl)benzoic acid |
| InChIKey | SKYJBEYFTBBNEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)