Products 78442-42-9
CAS 78442-42-9 is the registry number for Methyl 6-[(dimethylamino)carbonyl]-2-pyridinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 6-(dimethylcarbamoyl)pyridine-2-carboxylate (CAS 78442-42-9) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 6-(dimethylcarbamoyl)pyridine-2-carboxylate. InChIKey: XIDIMHCCDGNIFC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 6-(dimethylcarbamoyl)pyridine-2-carboxylate |
| InChIKey | XIDIMHCCDGNIFC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)