CAS 78540-03-1 appears in our catalog under these names: 1-Phenyl-1H-pyrrole-2-carboxylic acid, 96%, 1-Phenyl-1H-pyrrole-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-phenylpyrrole-2-carboxylic acid (CAS 78540-03-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-phenylpyrrole-2-carboxylic acid. InChIKey: GMLCQPJLSFPJMX-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-phenylpyrrole-2-carboxylic acid |
| InChIKey | GMLCQPJLSFPJMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CC=C2C(=O)O |
Computed by PubChem (NCBI)