CAS 78543-08-5 appears in our catalog under these names: Flurbiprofen Impurity J, Flurbiprofen Impurity 51, 1,3-Diethyl 2-(4-amino-3-fluorophenyl)-2-methylpropanedioate. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 100mg, 250mg, 1g.
Diethyl 2-(4-amino-3-fluorophenyl)-2-methylpropanedioate (CAS 78543-08-5) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: diethyl 2-(4-amino-3-fluorophenyl)-2-methylpropanedioate. InChIKey: AXSSLCGWLSGEET-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | diethyl 2-(4-amino-3-fluorophenyl)-2-methylpropanedioate |
| InChIKey | AXSSLCGWLSGEET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C1=CC(=C(C=C1)N)F)C(=O)OCC |
Computed by PubChem (NCBI)