Products 78594-13-5
CAS 78594-13-5 is the registry number for 1-(2,4-Dimethylphenyl)-2-phenylacetylene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2,4-dimethyl-1-(2-phenylethynyl)benzene (CAS 78594-13-5) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 2,4-dimethyl-1-(2-phenylethynyl)benzene. InChIKey: SDIAWMORWPJIRX-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2,4-dimethyl-1-(2-phenylethynyl)benzene |
| InChIKey | SDIAWMORWPJIRX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C#CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)