CAS 78603-95-9 appears in our catalog under these names: (S)–(–)–2–Amino–3–methyl–1,1–diphenyl–1–butanol, (S)-(-)-2-Amino-3-methyl-1,1-diphenyl-1-butanol, >98.0%(HPLC)(T), S-2-AMino-3-Methyl-1,1-diphenylbutan-1-ol, 97%, 97%, S-2-Amino-3-methyl-1,1-diphenylbutan-1-ol, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 250mg.
(2S)-2-amino-3-methyl-1,1-diphenylbutan-1-ol (CAS 78603-95-9) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (2S)-2-amino-3-methyl-1,1-diphenylbutan-1-ol. InChIKey: LNQVZZGGOZBOQS-INIZCTEOSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-1,1-diphenylbutan-1-ol |
| InChIKey | LNQVZZGGOZBOQS-INIZCTEOSA-N |
| SMILES | CC(C)[C@@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)