Products 86695-06-9
CAS 86695-06-9 appears in our catalog under these names: (R)–(+)–2–Amino–3–methyl–1,1–diphenyl–1–butanol, (R)-(+)-2-Amino-3-methyl-1,1-diphenyl-1-butanol, >98.0%(HPLC)(T), (R)-(+)-2-AMINO-3-METHYL-1,1-DIPHENYL-1-BUTANOL, 98%, 98%, (R)-(+)-2-Amino-3-methyl-1,1-diphenyl-1-butanol, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
(2R)-2-amino-3-methyl-1,1-diphenylbutan-1-ol (CAS 86695-06-9) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (2R)-2-amino-3-methyl-1,1-diphenylbutan-1-ol. InChIKey: LNQVZZGGOZBOQS-MRXNPFEDSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (2R)-2-amino-3-methyl-1,1-diphenylbutan-1-ol |
| InChIKey | LNQVZZGGOZBOQS-MRXNPFEDSA-N |
| SMILES | CC(C)[C@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)