Products 78648-35-8
CAS 78648-35-8 is the registry number for 2-(2-Oxopiperidin-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-oxopiperidin-1-yl)benzoic acid (CAS 78648-35-8) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 2-(2-oxopiperidin-1-yl)benzoic acid. InChIKey: JSLGWWWSTMZEOU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-(2-oxopiperidin-1-yl)benzoic acid |
| InChIKey | JSLGWWWSTMZEOU-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)