CAS 786728-87-8 appears in our catalog under these names: 3-{4-methoxy-3-((propan-2-yl)sulfamoyl)phenyl}prop-2-enoic acid, 95%, (2E)-3-{4-Methoxy-3-((propan-2-yl)sulfamoyl)phenyl}prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(E)-3-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]prop-2-enoic acid (CAS 786728-87-8) is a chemical compound with the molecular formula C13H17NO5S and a molecular weight of 299.34 g/mol. IUPAC name: (E)-3-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]prop-2-enoic acid. InChIKey: CKQVXJBNKZGLEF-FNORWQNLSA-N.
| Molecular formula | C13H17NO5S |
|---|---|
| Molecular weight | 299.34 g/mol |
| IUPAC name | (E)-3-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]prop-2-enoic acid |
| InChIKey | CKQVXJBNKZGLEF-FNORWQNLSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=C(C=CC(=C1)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)