CAS 78712-67-1 is the registry number for Ozagrel Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (E)-3-[4-(bromomethyl)phenyl]prop-2-enoate (CAS 78712-67-1) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: ethyl (E)-3-[4-(bromomethyl)phenyl]prop-2-enoate. InChIKey: ZIRVAUOPXCOSFU-BQYQJAHWSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | ethyl (E)-3-[4-(bromomethyl)phenyl]prop-2-enoate |
| InChIKey | ZIRVAUOPXCOSFU-BQYQJAHWSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)CBr |
Computed by PubChem (NCBI)