CAS 78756-36-2 appears in our catalog under these names: 7–Bromo–4–methyl–3,4–dihydro–1H–benzo(e)(1,4)diazepine–2,5–dione, 7-Bromo-4-methyl-3,4-dihydro-1H-benzo(E)(1,4)diazepine-2,5-dione. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
7-bromo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (CAS 78756-36-2) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 7-bromo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: KKJBJTGEGMJZCG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 7-bromo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| InChIKey | KKJBJTGEGMJZCG-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)