CAS 78787-78-7 appears in our catalog under these names: 1,7–Dimethyl–9H–carbazole, 1,7-Dimethyl-9H-carbazole 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,7-dimethyl-9H-carbazole (CAS 78787-78-7) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 1,7-dimethyl-9H-carbazole. InChIKey: JDYXUXQFJAPJGX-UHFFFAOYSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 1,7-dimethyl-9H-carbazole |
| InChIKey | JDYXUXQFJAPJGX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC=CC(=C3N2)C |
Computed by PubChem (NCBI)