Products 789469-67-6
CAS 789469-67-6 appears in our catalog under these names: 2-(4-Isopropylphenoxy)-2-methyl-3-phenylpropanoic acid, 95%, 2-(4-Isopropylphenoxy)-2-methyl-3-phenylpropanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-methyl-3-phenyl-2-(4-propan-2-ylphenoxy)propanoic acid (CAS 789469-67-6) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: 2-methyl-3-phenyl-2-(4-propan-2-ylphenoxy)propanoic acid. InChIKey: MAULTKITWQRAEN-UHFFFAOYSA-N.
| Molecular formula | C19H22O3 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2-methyl-3-phenyl-2-(4-propan-2-ylphenoxy)propanoic acid |
| InChIKey | MAULTKITWQRAEN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)OC(C)(CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)