CAS 1171923-55-9 is the registry number for 2-(3-(2,5-Dimethylphenyl)propyl)-6-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoic acid (CAS 1171923-55-9) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: 2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoic acid. InChIKey: NPRDVHBXTCVOAU-UHFFFAOYSA-N.
| Molecular formula | C19H22O3 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoic acid |
| InChIKey | NPRDVHBXTCVOAU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CCCC2=C(C(=CC=C2)OC)C(=O)O |
Computed by PubChem (NCBI)