Products 1171923-55-9

CAS 1171923-55-9 is the registry number for 2-(3-(2,5-Dimethylphenyl)propyl)-6-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoic acid (CAS 1171923-55-9) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: 2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoic acid. InChIKey: NPRDVHBXTCVOAU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22O3
Molecular weight298.4 g/mol
IUPAC name2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoic acid
InChIKeyNPRDVHBXTCVOAU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)CCCC2=C(C(=CC=C2)OC)C(=O)O

Computed by PubChem (NCBI)